C44H34ClN5O — CID 57084982
5-chloro-2-ethyl-4-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methoxy]quinoline (PubChem CID 57084982) has the molecular formula C44H34ClN5O and a molecular weight of 684.24 g/mol. Its IUPAC name is 5-chloro-2-ethyl-4-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methoxy]quinoline.
| Compound Name | 5-chloro-2-ethyl-4-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methoxy]quinoline |
|---|---|
| PubChem CID | 57084982 |
| Molecular Formula | C44H34ClN5O |
| Molecular Weight | 684.24 g/mol |
| Exact Mass | 683.25 |
| IUPAC Name | 5-chloro-2-ethyl-4-[[4-[2-(5-trityltetrazol-5-yl)phenyl]phenyl]methoxy]quinoline |
| SMILES | CCc1cc(OCc2ccc(-c3ccccc3C3(C(c4ccccc4)(c4ccccc4)c4ccccc4)N=NN=N3)cc2)c2c(Cl)cccc2n1 |
| InChI | InChI=1S/C44H34ClN5O/c1-2-36-29-41(42-39(45)23-14-24-40(42)46-36)51-30-31-25-27-32(28-26-31)37-21-12-13-22-38(37)44(47-49-50-48-44)43(33-15-6-3-7-16-33,34-17-8-4-9-18-34)35-19-10-5-11-20-35/h3-29H,2,30H2,1H3 |
| InChIKey | WZEZREMLEJUHLE-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 71.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.24 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|