About O-propyl (2S)-1-(3,3-dimethyl-2-oxopentanoyl)-3-(3-fluorophenyl)pyrrolidine-2-carbothioate
O-propyl (2S)-1-(3,3-dimethyl-2-oxopentanoyl)-3-(3-fluorophenyl)pyrrolidine-2-carbothioate (PubChem CID 57085218) has the molecular formula C21H28FNO3S
and a molecular weight of 393.52 g/mol. Its IUPAC name is O-propyl (2S)-1-(3,3-dimethyl-2-oxopentanoyl)-3-(3-fluorophenyl)pyrrolidine-2-carbothioate.
Molecular Properties
| Compound Name | O-propyl (2S)-1-(3,3-dimethyl-2-oxopentanoyl)-3-(3-fluorophenyl)pyrrolidine-2-carbothioate |
| PubChem CID | 57085218 |
| Molecular Formula | C21H28FNO3S |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | O-propyl (2S)-1-(3,3-dimethyl-2-oxopentanoyl)-3-(3-fluorophenyl)pyrrolidine-2-carbothioate |
| SMILES | CCCOC(=S)[C@@H]1C(c2cccc(F)c2)CCN1C(=O)C(=O)C(C)(C)CC |
| InChI | InChI=1S/C21H28FNO3S/c1-5-12-26-20(27)17-16(14-8-7-9-15(22)13-14)10-11-23(17)19(25)18(24)21(3,4)6-2/h7-9,13,16-17H,5-6,10-12H2,1-4H3/t16?,17-/m0/s1 |
| InChIKey | NIOPDCCCCGLGBZ-DJNXLDHESA-N |
| XLogP | 4.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-propyl (2S)-1-(3,3-dimethyl-2-oxopentanoyl)-3-(3-fluorophenyl)pyrrolidine-2-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-propyl (2S)-1-(3,3-dimethyl-2-oxopentanoyl)-3-(3-fluorophenyl)pyrrolidine-2-carbothioate?
The IUPAC name of O-propyl (2S)-1-(3,3-dimethyl-2-oxopentanoyl)-3-(3-fluorophenyl)pyrrolidine-2-carbothioate (CID 57085218) is O-propyl (2S)-1-(3,3-dimethyl-2-oxopentanoyl)-3-(3-fluorophenyl)pyrrolidine-2-carbothioate.
What is the SMILES notation for O-propyl (2S)-1-(3,3-dimethyl-2-oxopentanoyl)-3-(3-fluorophenyl)pyrrolidine-2-carbothioate?
The canonical SMILES for O-propyl (2S)-1-(3,3-dimethyl-2-oxopentanoyl)-3-(3-fluorophenyl)pyrrolidine-2-carbothioate is CCCOC(=S)[C@@H]1C(c2cccc(F)c2)CCN1C(=O)C(=O)C(C)(C)CC.
What is the InChIKey of O-propyl (2S)-1-(3,3-dimethyl-2-oxopentanoyl)-3-(3-fluorophenyl)pyrrolidine-2-carbothioate?
The InChIKey is NIOPDCCCCGLGBZ-DJNXLDHESA-N. The full InChI is InChI=1S/C21H28FNO3S/c1-5-12-26-20(27)17-16(14-8-7-9-15(22)13-14)10-11-23(17)19(25)18(24)21(3,4)6-2/h7-9,13,16-17H,5-6,10-12H2,1-4H3/t16?,17-/m0/s1.
What are the key properties of O-propyl (2S)-1-(3,3-dimethyl-2-oxopentanoyl)-3-(3-fluorophenyl)pyrrolidine-2-carbothioate?
O-propyl (2S)-1-(3,3-dimethyl-2-oxopentanoyl)-3-(3-fluorophenyl)pyrrolidine-2-carbothioate has a molecular weight of 393.52 g/mol, XLogP of 4.27, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-propyl (2S)-1-(3,3-dimethyl-2-oxopentanoyl)-3-(3-fluorophenyl)pyrrolidine-2-carbothioate is sourced from PubChem (CID 57085218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).