C49H47N2O3P — CID 57085310
(3aR,4R,8R,8aR)-4,8-dibenzyl-2,2-dimethyl-5,7-bis(naphthalen-2-ylmethyl)-6-phenoxy-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3,2]diazaphosphepine (PubChem CID 57085310) has the molecular formula C49H47N2O3P and a molecular weight of 742.90 g/mol. Its IUPAC name is (3aR,4R,8R,8aR)-4,8-dibenzyl-2,2-dimethyl-5,7-bis(naphthalen-2-ylmethyl)-6-phenoxy-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3,2]diazaphosphepine.
| Compound Name | (3aR,4R,8R,8aR)-4,8-dibenzyl-2,2-dimethyl-5,7-bis(naphthalen-2-ylmethyl)-6-phenoxy-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3,2]diazaphosphepine |
|---|---|
| PubChem CID | 57085310 |
| Molecular Formula | C49H47N2O3P |
| Molecular Weight | 742.90 g/mol |
| Exact Mass | 742.33 |
| IUPAC Name | (3aR,4R,8R,8aR)-4,8-dibenzyl-2,2-dimethyl-5,7-bis(naphthalen-2-ylmethyl)-6-phenoxy-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3,2]diazaphosphepine |
| SMILES | CC1(C)O[C@H]2[C@H](O1)[C@@H](Cc1ccccc1)N(Cc1ccc3ccccc3c1)P(Oc1ccccc1)N(Cc1ccc3ccccc3c1)[C@@H]2Cc1ccccc1 |
| InChI | InChI=1S/C49H47N2O3P/c1-49(2)52-47-45(32-36-16-6-3-7-17-36)50(34-38-26-28-40-20-12-14-22-42(40)30-38)55(54-44-24-10-5-11-25-44)51(35-39-27-29-41-21-13-15-23-43(41)31-39)46(48(47)53-49)33-37-18-8-4-9-19-37/h3-31,45-48H,32-35H2,1-2H3/t45-,46-,47-,48-/m1/s1 |
| InChIKey | RAXKCTHIXUPSHK-MABAWHDTSA-N |
| XLogP | 11.36 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.90 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|