C28H33FN4O6 — CID 57085329
methyl 2-ethoxy-2-[[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]acetate (PubChem CID 57085329) has the molecular formula C28H33FN4O6 and a molecular weight of 540.59 g/mol. Its IUPAC name is methyl 2-ethoxy-2-[[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]acetate.
| Compound Name | methyl 2-ethoxy-2-[[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]acetate |
|---|---|
| PubChem CID | 57085329 |
| Molecular Formula | C28H33FN4O6 |
| Molecular Weight | 540.59 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | methyl 2-ethoxy-2-[[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]acetate |
| SMILES | CCOC(C(=O)OC)N(C(N)=NC(=O)OC(C)(C)C)c1cc(C(C)c2ccc(-c3ccccc3)c(F)c2)no1 |
| InChI | InChI=1S/C28H33FN4O6/c1-7-37-24(25(34)36-6)33(26(30)31-27(35)38-28(3,4)5)23-16-22(32-39-23)17(2)19-13-14-20(21(29)15-19)18-11-9-8-10-12-18/h8-17,24H,7H2,1-6H3,(H2,30,31,35) |
| InChIKey | HZCDWRCGFWUDNF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 129.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|