C28H38F3NO2 — CID 57085331
(3aS,3bR,9aR,9bR,11aS)-2,4,6,9a,11a-pentamethyl-1-[4-(trifluoromethyl)phenoxy]-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one (PubChem CID 57085331) has the molecular formula C28H38F3NO2 and a molecular weight of 477.61 g/mol. Its IUPAC name is (3aS,3bR,9aR,9bR,11aS)-2,4,6,9a,11a-pentamethyl-1-[4-(trifluoromethyl)phenoxy]-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,3bR,9aR,9bR,11aS)-2,4,6,9a,11a-pentamethyl-1-[4-(trifluoromethyl)phenoxy]-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 57085331 |
| Molecular Formula | C28H38F3NO2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | (3aS,3bR,9aR,9bR,11aS)-2,4,6,9a,11a-pentamethyl-1-[4-(trifluoromethyl)phenoxy]-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
| SMILES | CC1C[C@H]2[C@@H]3C(C)CC4N(C)C(=O)CC[C@]4(C)[C@@H]3CC[C@]2(C)C1Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H38F3NO2/c1-16-15-22-26(3,13-11-23(33)32(22)5)20-10-12-27(4)21(24(16)20)14-17(2)25(27)34-19-8-6-18(7-9-19)28(29,30)31/h6-9,16-17,20-22,24-25H,10-15H2,1-5H3/t16?,17?,20-,21+,22?,24-,25?,26-,27+/m1/s1 |
| InChIKey | JEVMRBYCJCNLAU-LPUKPFEASA-N |
| XLogP | 6.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |