C24H27N3 — CID 57085358
(3S)-3-benzyl-1-(2,3-dimethyl-4-pyridin-4-ylphenyl)piperazine (PubChem CID 57085358) has the molecular formula C24H27N3 and a molecular weight of 357.50 g/mol. Its IUPAC name is (3S)-3-benzyl-1-(2,3-dimethyl-4-pyridin-4-ylphenyl)piperazine.
| Compound Name | (3S)-3-benzyl-1-(2,3-dimethyl-4-pyridin-4-ylphenyl)piperazine |
|---|---|
| PubChem CID | 57085358 |
| Molecular Formula | C24H27N3 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | (3S)-3-benzyl-1-(2,3-dimethyl-4-pyridin-4-ylphenyl)piperazine |
| SMILES | Cc1c(-c2ccncc2)ccc(N2CCN[C@@H](Cc3ccccc3)C2)c1C |
| InChI | InChI=1S/C24H27N3/c1-18-19(2)24(9-8-23(18)21-10-12-25-13-11-21)27-15-14-26-22(17-27)16-20-6-4-3-5-7-20/h3-13,22,26H,14-17H2,1-2H3/t22-/m0/s1 |
| InChIKey | GMULLZMKDHBGGX-QFIPXVFZSA-N |
| XLogP | 4.39 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |