About tert-butyl (2R)-1-[2,3-bis(acetylsulfanyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylate
tert-butyl (2R)-1-[2,3-bis(acetylsulfanyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylate (PubChem CID 57085984) has the molecular formula C17H28NO5S2+
and a molecular weight of 390.55 g/mol. Its IUPAC name is tert-butyl (2R)-1-[2,3-bis(acetylsulfanyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2R)-1-[2,3-bis(acetylsulfanyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylate |
| PubChem CID | 57085984 |
| Molecular Formula | C17H28NO5S2+ |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | tert-butyl (2R)-1-[2,3-bis(acetylsulfanyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylate |
| SMILES | CC(=O)SCC(SC(C)=O)C(=O)[N+]1(C(=O)OC(C)(C)C)CCC[C@H]1C |
| InChI | InChI=1S/C17H28NO5S2/c1-11-8-7-9-18(11,16(22)23-17(4,5)6)15(21)14(25-13(3)20)10-24-12(2)19/h11,14H,7-10H2,1-6H3/q+1/t11-,14?,18?/m1/s1 |
| InChIKey | SNDSFYNOOWDROL-NWCKJHLDSA-N |
| XLogP | 3.38 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2R)-1-[2,3-bis(acetylsulfanyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R)-1-[2,3-bis(acetylsulfanyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylate?
The IUPAC name of tert-butyl (2R)-1-[2,3-bis(acetylsulfanyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylate (CID 57085984) is tert-butyl (2R)-1-[2,3-bis(acetylsulfanyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylate.
What is the SMILES notation for tert-butyl (2R)-1-[2,3-bis(acetylsulfanyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylate?
The canonical SMILES for tert-butyl (2R)-1-[2,3-bis(acetylsulfanyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylate is CC(=O)SCC(SC(C)=O)C(=O)[N+]1(C(=O)OC(C)(C)C)CCC[C@H]1C.
What is the InChIKey of tert-butyl (2R)-1-[2,3-bis(acetylsulfanyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylate?
The InChIKey is SNDSFYNOOWDROL-NWCKJHLDSA-N. The full InChI is InChI=1S/C17H28NO5S2/c1-11-8-7-9-18(11,16(22)23-17(4,5)6)15(21)14(25-13(3)20)10-24-12(2)19/h11,14H,7-10H2,1-6H3/q+1/t11-,14?,18?/m1/s1.
What are the key properties of tert-butyl (2R)-1-[2,3-bis(acetylsulfanyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylate?
tert-butyl (2R)-1-[2,3-bis(acetylsulfanyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylate has a molecular weight of 390.55 g/mol, XLogP of 3.38, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R)-1-[2,3-bis(acetylsulfanyl)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylate is sourced from PubChem (CID 57085984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).