C10H17N — CID 57086307
3-butyl-6-methyl-2,5-dihydropyridine (PubChem CID 57086307) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 3-butyl-6-methyl-2,5-dihydropyridine.
| Compound Name | 3-butyl-6-methyl-2,5-dihydropyridine |
|---|---|
| PubChem CID | 57086307 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 3-butyl-6-methyl-2,5-dihydropyridine |
| SMILES | CCCCC1=CCC(C)=NC1 |
| InChI | InChI=1S/C10H17N/c1-3-4-5-10-7-6-9(2)11-8-10/h7H,3-6,8H2,1-2H3 |
| InChIKey | SQLCAKOQVVNHGY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|