About 3,7-dihydro-2H-furo[2,3-c]pyran
3,7-dihydro-2H-furo[2,3-c]pyran (PubChem CID 57086505) has the molecular formula C7H8O2
and a molecular weight of 124.14 g/mol. Its IUPAC name is 3,7-dihydro-2H-furo[2,3-c]pyran.
Molecular Properties
| Compound Name | 3,7-dihydro-2H-furo[2,3-c]pyran |
| PubChem CID | 57086505 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | 3,7-dihydro-2H-furo[2,3-c]pyran |
| SMILES | C1=CC2=C(CO1)OCC2 |
| InChI | InChI=1S/C7H8O2/c1-3-8-5-7-6(1)2-4-9-7/h1,3H,2,4-5H2 |
| InChIKey | RVUOFJCSWDXUGA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,7-dihydro-2H-furo[2,3-c]pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dihydro-2H-furo[2,3-c]pyran?
The IUPAC name of 3,7-dihydro-2H-furo[2,3-c]pyran (CID 57086505) is 3,7-dihydro-2H-furo[2,3-c]pyran.
What is the SMILES notation for 3,7-dihydro-2H-furo[2,3-c]pyran?
The canonical SMILES for 3,7-dihydro-2H-furo[2,3-c]pyran is C1=CC2=C(CO1)OCC2.
What is the InChIKey of 3,7-dihydro-2H-furo[2,3-c]pyran?
The InChIKey is RVUOFJCSWDXUGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2/c1-3-8-5-7-6(1)2-4-9-7/h1,3H,2,4-5H2.
What are the key properties of 3,7-dihydro-2H-furo[2,3-c]pyran?
3,7-dihydro-2H-furo[2,3-c]pyran has a molecular weight of 124.14 g/mol, XLogP of 1.20, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dihydro-2H-furo[2,3-c]pyran is sourced from PubChem (CID 57086505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).