About N-ethyl-2,4-dimethylcyclohexan-1-amine
N-ethyl-2,4-dimethylcyclohexan-1-amine (PubChem CID 57086711) has the molecular formula C10H21N
and a molecular weight of 155.28 g/mol. Its IUPAC name is N-ethyl-2,4-dimethylcyclohexan-1-amine.
Molecular Properties
| Compound Name | N-ethyl-2,4-dimethylcyclohexan-1-amine |
| PubChem CID | 57086711 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | N-ethyl-2,4-dimethylcyclohexan-1-amine |
| SMILES | CCNC1CCC(C)CC1C |
| InChI | InChI=1S/C10H21N/c1-4-11-10-6-5-8(2)7-9(10)3/h8-11H,4-7H2,1-3H3 |
| InChIKey | BOZBDJRCACQFEI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyl-2,4-dimethylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,4-dimethylcyclohexan-1-amine?
The IUPAC name of N-ethyl-2,4-dimethylcyclohexan-1-amine (CID 57086711) is N-ethyl-2,4-dimethylcyclohexan-1-amine.
What is the SMILES notation for N-ethyl-2,4-dimethylcyclohexan-1-amine?
The canonical SMILES for N-ethyl-2,4-dimethylcyclohexan-1-amine is CCNC1CCC(C)CC1C.
What is the InChIKey of N-ethyl-2,4-dimethylcyclohexan-1-amine?
The InChIKey is BOZBDJRCACQFEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N/c1-4-11-10-6-5-8(2)7-9(10)3/h8-11H,4-7H2,1-3H3.
What are the key properties of N-ethyl-2,4-dimethylcyclohexan-1-amine?
N-ethyl-2,4-dimethylcyclohexan-1-amine has a molecular weight of 155.28 g/mol, XLogP of 2.42, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,4-dimethylcyclohexan-1-amine is sourced from PubChem (CID 57086711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).