C17H19N3O3 — CID 57087215
ethyl 3-(6-imino-9,11-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-5-yl)-2-oxopropanoate (PubChem CID 57087215) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is ethyl 3-(6-imino-9,11-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-5-yl)-2-oxopropanoate.
| Compound Name | ethyl 3-(6-imino-9,11-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-5-yl)-2-oxopropanoate |
|---|---|
| PubChem CID | 57087215 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | ethyl 3-(6-imino-9,11-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-5-yl)-2-oxopropanoate |
| SMILES | [H]/N=C1\C2C=CCN2Cc2ccccc2N1CC(=O)C(=O)OCC |
| InChI | InChI=1S/C17H19N3O3/c1-2-23-17(22)15(21)11-20-13-7-4-3-6-12(13)10-19-9-5-8-14(19)16(20)18/h3-8,14,18H,2,9-11H2,1H3/b18-16+ |
| InChIKey | CZERBBCMAUXCMK-FBMGVBCBSA-N |
| XLogP | 1.36 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|