C37H33N3O5S2 — CID 57087359
2-[4,4-bis[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]cyclohexanecarboximidoyl]oxyacetic acid (PubChem CID 57087359) has the molecular formula C37H33N3O5S2 and a molecular weight of 663.82 g/mol. Its IUPAC name is 2-[4,4-bis[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]cyclohexanecarboximidoyl]oxyacetic acid.
| Compound Name | 2-[4,4-bis[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]cyclohexanecarboximidoyl]oxyacetic acid |
|---|---|
| PubChem CID | 57087359 |
| Molecular Formula | C37H33N3O5S2 |
| Molecular Weight | 663.82 g/mol |
| Exact Mass | 663.19 |
| IUPAC Name | 2-[4,4-bis[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]cyclohexanecarboximidoyl]oxyacetic acid |
| SMILES | [H]/N=C(\OCC(=O)O)C1CCC(c2ccc(OCc3nc4ccccc4s3)cc2)(c2ccc(OCc3nc4ccccc4s3)cc2)CC1 |
| InChI | InChI=1S/C37H33N3O5S2/c38-36(45-23-35(41)42)24-17-19-37(20-18-24,25-9-13-27(14-10-25)43-21-33-39-29-5-1-3-7-31(29)46-33)26-11-15-28(16-12-26)44-22-34-40-30-6-2-4-8-32(30)47-34/h1-16,24,38H,17-23H2,(H,41,42)/b38-36- |
| InChIKey | MCBTXRXIJHIARP-WASYMBJWSA-N |
| XLogP | 8.62 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.82 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|