About 2-[tert-butyl(propa-1,2-dienoxy)phosphoryl]oxy-2-methylpropane
2-[tert-butyl(propa-1,2-dienoxy)phosphoryl]oxy-2-methylpropane (PubChem CID 57087411) has the molecular formula C11H21O3P
and a molecular weight of 232.26 g/mol. Its IUPAC name is 2-[tert-butyl(propa-1,2-dienoxy)phosphoryl]oxy-2-methylpropane.
Molecular Properties
| Compound Name | 2-[tert-butyl(propa-1,2-dienoxy)phosphoryl]oxy-2-methylpropane |
| PubChem CID | 57087411 |
| Molecular Formula | C11H21O3P |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 2-[tert-butyl(propa-1,2-dienoxy)phosphoryl]oxy-2-methylpropane |
| SMILES | C=C=COP(=O)(OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H21O3P/c1-8-9-13-15(12,11(5,6)7)14-10(2,3)4/h9H,1H2,2-7H3 |
| InChIKey | KACPFMCLBVACSD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[tert-butyl(propa-1,2-dienoxy)phosphoryl]oxy-2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[tert-butyl(propa-1,2-dienoxy)phosphoryl]oxy-2-methylpropane?
The IUPAC name of 2-[tert-butyl(propa-1,2-dienoxy)phosphoryl]oxy-2-methylpropane (CID 57087411) is 2-[tert-butyl(propa-1,2-dienoxy)phosphoryl]oxy-2-methylpropane.
What is the SMILES notation for 2-[tert-butyl(propa-1,2-dienoxy)phosphoryl]oxy-2-methylpropane?
The canonical SMILES for 2-[tert-butyl(propa-1,2-dienoxy)phosphoryl]oxy-2-methylpropane is C=C=COP(=O)(OC(C)(C)C)C(C)(C)C.
What is the InChIKey of 2-[tert-butyl(propa-1,2-dienoxy)phosphoryl]oxy-2-methylpropane?
The InChIKey is KACPFMCLBVACSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21O3P/c1-8-9-13-15(12,11(5,6)7)14-10(2,3)4/h9H,1H2,2-7H3.
What are the key properties of 2-[tert-butyl(propa-1,2-dienoxy)phosphoryl]oxy-2-methylpropane?
2-[tert-butyl(propa-1,2-dienoxy)phosphoryl]oxy-2-methylpropane has a molecular weight of 232.26 g/mol, XLogP of 4.11, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[tert-butyl(propa-1,2-dienoxy)phosphoryl]oxy-2-methylpropane is sourced from PubChem (CID 57087411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).