C11H16N2 — CID 57087941
N,N-dimethyl-6,7,8,8a-tetrahydroquinolin-7-amine (PubChem CID 57087941) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is N,N-dimethyl-6,7,8,8a-tetrahydroquinolin-7-amine.
| Compound Name | N,N-dimethyl-6,7,8,8a-tetrahydroquinolin-7-amine |
|---|---|
| PubChem CID | 57087941 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N,N-dimethyl-6,7,8,8a-tetrahydroquinolin-7-amine |
| SMILES | CN(C)C1CC=C2C=CC=NC2C1 |
| InChI | InChI=1S/C11H16N2/c1-13(2)10-6-5-9-4-3-7-12-11(9)8-10/h3-5,7,10-11H,6,8H2,1-2H3 |
| InChIKey | WBBUTZPOWHZICC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |