About CID 5708810
CID 5708810 (PubChem CID 5708810) has the molecular formula C5H13IN4O
and a molecular weight of 272.09 g/mol. Its IUPAC name is N'-aminomorpholine-4-carboximidamide;hydroiodide.
Molecular Properties
| Compound Name | CID 5708810 |
| PubChem CID | 5708810 |
| Molecular Formula | C5H13IN4O |
| Molecular Weight | 272.09 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | N'-aminomorpholine-4-carboximidamide;hydroiodide |
| SMILES | C1COCCN1/C(=N\N)/N.I |
| InChI | InChI=1S/C5H12N4O.HI/c6-5(8-7)9-1-3-10-4-2-9;/h1-4,7H2,(H2,6,8);1H |
| InChIKey | YXNSDJJTIYZVOV-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 76.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | 130 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 5708810 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 5708810?
The IUPAC name of CID 5708810 (CID 5708810) is N'-aminomorpholine-4-carboximidamide;hydroiodide.
What is the SMILES notation for CID 5708810?
The canonical SMILES for CID 5708810 is C1COCCN1/C(=N\N)/N.I.
What is the InChIKey of CID 5708810?
The InChIKey is YXNSDJJTIYZVOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N4O.HI/c6-5(8-7)9-1-3-10-4-2-9;/h1-4,7H2,(H2,6,8);1H.
What are the key properties of CID 5708810?
CID 5708810 has a molecular weight of 272.09 g/mol, XLogP of not available, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 5708810 is sourced from PubChem (CID 5708810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).