C18H12F5NOS — CID 57088879
N-[1-[4-(2,3,4,5,6-pentafluorophenoxy)phenyl]ethyl]thiophen-3-amine (PubChem CID 57088879) has the molecular formula C18H12F5NOS and a molecular weight of 385.36 g/mol. Its IUPAC name is N-[1-[4-(2,3,4,5,6-pentafluorophenoxy)phenyl]ethyl]thiophen-3-amine.
| Compound Name | N-[1-[4-(2,3,4,5,6-pentafluorophenoxy)phenyl]ethyl]thiophen-3-amine |
|---|---|
| PubChem CID | 57088879 |
| Molecular Formula | C18H12F5NOS |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | N-[1-[4-(2,3,4,5,6-pentafluorophenoxy)phenyl]ethyl]thiophen-3-amine |
| SMILES | CC(Nc1ccsc1)c1ccc(Oc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C18H12F5NOS/c1-9(24-11-6-7-26-8-11)10-2-4-12(5-3-10)25-18-16(22)14(20)13(19)15(21)17(18)23/h2-9,24H,1H3 |
| InChIKey | POUDZHWLHXCCBM-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|