About 2-(diazenylmethyl)-2,3,3-trimethylbutanenitrile
2-(diazenylmethyl)-2,3,3-trimethylbutanenitrile (PubChem CID 57089113) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is 2-(diazenylmethyl)-2,3,3-trimethylbutanenitrile.
Molecular Properties
| Compound Name | 2-(diazenylmethyl)-2,3,3-trimethylbutanenitrile |
| PubChem CID | 57089113 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 2-(diazenylmethyl)-2,3,3-trimethylbutanenitrile |
| SMILES | [H]/N=N/CC(C)(C#N)C(C)(C)C |
| InChI | InChI=1S/C8H15N3/c1-7(2,3)8(4,5-9)6-11-10/h10H,6H2,1-4H3/b11-10+ |
| InChIKey | ALOSKYWASFGTGG-ZHACJKMWSA-N |
| XLogP | 2.59 |
| TPSA | 60.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(diazenylmethyl)-2,3,3-trimethylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diazenylmethyl)-2,3,3-trimethylbutanenitrile?
The IUPAC name of 2-(diazenylmethyl)-2,3,3-trimethylbutanenitrile (CID 57089113) is 2-(diazenylmethyl)-2,3,3-trimethylbutanenitrile.
What is the SMILES notation for 2-(diazenylmethyl)-2,3,3-trimethylbutanenitrile?
The canonical SMILES for 2-(diazenylmethyl)-2,3,3-trimethylbutanenitrile is [H]/N=N/CC(C)(C#N)C(C)(C)C.
What is the InChIKey of 2-(diazenylmethyl)-2,3,3-trimethylbutanenitrile?
The InChIKey is ALOSKYWASFGTGG-ZHACJKMWSA-N. The full InChI is InChI=1S/C8H15N3/c1-7(2,3)8(4,5-9)6-11-10/h10H,6H2,1-4H3/b11-10+.
What are the key properties of 2-(diazenylmethyl)-2,3,3-trimethylbutanenitrile?
2-(diazenylmethyl)-2,3,3-trimethylbutanenitrile has a molecular weight of 153.23 g/mol, XLogP of 2.59, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diazenylmethyl)-2,3,3-trimethylbutanenitrile is sourced from PubChem (CID 57089113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).