About tridec-2-ene-1-sulfinate
tridec-2-ene-1-sulfinate (PubChem CID 57089248) has the molecular formula C13H25O2S-
and a molecular weight of 245.41 g/mol. Its IUPAC name is tridec-2-ene-1-sulfinate.
Molecular Properties
| Compound Name | tridec-2-ene-1-sulfinate |
| PubChem CID | 57089248 |
| Molecular Formula | C13H25O2S- |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | tridec-2-ene-1-sulfinate |
| SMILES | CCCCCCCCCCC=CCS(=O)[O-] |
| InChI | InChI=1S/C13H26O2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16(14)15/h11-12H,2-10,13H2,1H3,(H,14,15)/p-1 |
| InChIKey | AXEHIFKJFRLHBU-UHFFFAOYSA-M |
| XLogP | 3.95 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze tridec-2-ene-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tridec-2-ene-1-sulfinate?
The IUPAC name of tridec-2-ene-1-sulfinate (CID 57089248) is tridec-2-ene-1-sulfinate.
What is the SMILES notation for tridec-2-ene-1-sulfinate?
The canonical SMILES for tridec-2-ene-1-sulfinate is CCCCCCCCCCC=CCS(=O)[O-].
What is the InChIKey of tridec-2-ene-1-sulfinate?
The InChIKey is AXEHIFKJFRLHBU-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H26O2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16(14)15/h11-12H,2-10,13H2,1H3,(H,14,15)/p-1.
What are the key properties of tridec-2-ene-1-sulfinate?
tridec-2-ene-1-sulfinate has a molecular weight of 245.41 g/mol, XLogP of 3.95, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tridec-2-ene-1-sulfinate is sourced from PubChem (CID 57089248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).