About 1-ethenyl-2-(1-ethenyl-4,5-dihydroimidazol-2-yl)-4,5-dihydroimidazole
1-ethenyl-2-(1-ethenyl-4,5-dihydroimidazol-2-yl)-4,5-dihydroimidazole (PubChem CID 57090193) has the molecular formula C10H14N4
and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-ethenyl-2-(1-ethenyl-4,5-dihydroimidazol-2-yl)-4,5-dihydroimidazole.
Molecular Properties
| Compound Name | 1-ethenyl-2-(1-ethenyl-4,5-dihydroimidazol-2-yl)-4,5-dihydroimidazole |
| PubChem CID | 57090193 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1-ethenyl-2-(1-ethenyl-4,5-dihydroimidazol-2-yl)-4,5-dihydroimidazole |
| SMILES | C=CN1CCN=C1C1=NCCN1C=C |
| InChI | InChI=1S/C10H14N4/c1-3-13-7-5-11-9(13)10-12-6-8-14(10)4-2/h3-4H,1-2,5-8H2 |
| InChIKey | IGUKHKQBYMZKBB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethenyl-2-(1-ethenyl-4,5-dihydroimidazol-2-yl)-4,5-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-2-(1-ethenyl-4,5-dihydroimidazol-2-yl)-4,5-dihydroimidazole?
The IUPAC name of 1-ethenyl-2-(1-ethenyl-4,5-dihydroimidazol-2-yl)-4,5-dihydroimidazole (CID 57090193) is 1-ethenyl-2-(1-ethenyl-4,5-dihydroimidazol-2-yl)-4,5-dihydroimidazole.
What is the SMILES notation for 1-ethenyl-2-(1-ethenyl-4,5-dihydroimidazol-2-yl)-4,5-dihydroimidazole?
The canonical SMILES for 1-ethenyl-2-(1-ethenyl-4,5-dihydroimidazol-2-yl)-4,5-dihydroimidazole is C=CN1CCN=C1C1=NCCN1C=C.
What is the InChIKey of 1-ethenyl-2-(1-ethenyl-4,5-dihydroimidazol-2-yl)-4,5-dihydroimidazole?
The InChIKey is IGUKHKQBYMZKBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4/c1-3-13-7-5-11-9(13)10-12-6-8-14(10)4-2/h3-4H,1-2,5-8H2.
What are the key properties of 1-ethenyl-2-(1-ethenyl-4,5-dihydroimidazol-2-yl)-4,5-dihydroimidazole?
1-ethenyl-2-(1-ethenyl-4,5-dihydroimidazol-2-yl)-4,5-dihydroimidazole has a molecular weight of 190.25 g/mol, XLogP of 0.70, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2-(1-ethenyl-4,5-dihydroimidazol-2-yl)-4,5-dihydroimidazole is sourced from PubChem (CID 57090193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).