About 4-(1,4,5-triphenylimidazol-2-yl)oxypentanoic acid
4-(1,4,5-triphenylimidazol-2-yl)oxypentanoic acid (PubChem CID 57090206) has the molecular formula C26H24N2O3
and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-(1,4,5-triphenylimidazol-2-yl)oxypentanoic acid.
Molecular Properties
| Compound Name | 4-(1,4,5-triphenylimidazol-2-yl)oxypentanoic acid |
| PubChem CID | 57090206 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 4-(1,4,5-triphenylimidazol-2-yl)oxypentanoic acid |
| SMILES | CC(CCC(=O)O)Oc1nc(-c2ccccc2)c(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C26H24N2O3/c1-19(17-18-23(29)30)31-26-27-24(20-11-5-2-6-12-20)25(21-13-7-3-8-14-21)28(26)22-15-9-4-10-16-22/h2-16,19H,17-18H2,1H3,(H,29,30) |
| InChIKey | JKJDAQXIBOQHJD-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,4,5-triphenylimidazol-2-yl)oxypentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,4,5-triphenylimidazol-2-yl)oxypentanoic acid?
The IUPAC name of 4-(1,4,5-triphenylimidazol-2-yl)oxypentanoic acid (CID 57090206) is 4-(1,4,5-triphenylimidazol-2-yl)oxypentanoic acid.
What is the SMILES notation for 4-(1,4,5-triphenylimidazol-2-yl)oxypentanoic acid?
The canonical SMILES for 4-(1,4,5-triphenylimidazol-2-yl)oxypentanoic acid is CC(CCC(=O)O)Oc1nc(-c2ccccc2)c(-c2ccccc2)n1-c1ccccc1.
What is the InChIKey of 4-(1,4,5-triphenylimidazol-2-yl)oxypentanoic acid?
The InChIKey is JKJDAQXIBOQHJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N2O3/c1-19(17-18-23(29)30)31-26-27-24(20-11-5-2-6-12-20)25(21-13-7-3-8-14-21)28(26)22-15-9-4-10-16-22/h2-16,19H,17-18H2,1H3,(H,29,30).
What are the key properties of 4-(1,4,5-triphenylimidazol-2-yl)oxypentanoic acid?
4-(1,4,5-triphenylimidazol-2-yl)oxypentanoic acid has a molecular weight of 412.49 g/mol, XLogP of 5.84, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,4,5-triphenylimidazol-2-yl)oxypentanoic acid is sourced from PubChem (CID 57090206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).