C18H34N2O3 — CID 57090390
2-amino-N-[(2S,3R,4S,5S)-4-methoxy-5-methyl-2-non-1-enyloxan-3-yl]acetamide (PubChem CID 57090390) has the molecular formula C18H34N2O3 and a molecular weight of 326.48 g/mol. Its IUPAC name is 2-amino-N-[(2S,3R,4S,5S)-4-methoxy-5-methyl-2-non-1-enyloxan-3-yl]acetamide.
| Compound Name | 2-amino-N-[(2S,3R,4S,5S)-4-methoxy-5-methyl-2-non-1-enyloxan-3-yl]acetamide |
|---|---|
| PubChem CID | 57090390 |
| Molecular Formula | C18H34N2O3 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | 2-amino-N-[(2S,3R,4S,5S)-4-methoxy-5-methyl-2-non-1-enyloxan-3-yl]acetamide |
| SMILES | CCCCCCCC=C[C@@H]1OC[C@H](C)[C@H](OC)[C@H]1NC(=O)CN |
| InChI | InChI=1S/C18H34N2O3/c1-4-5-6-7-8-9-10-11-15-17(20-16(21)12-19)18(22-3)14(2)13-23-15/h10-11,14-15,17-18H,4-9,12-13,19H2,1-3H3,(H,20,21)/t14-,15-,17-,18-/m0/s1 |
| InChIKey | COSOCOCTWPZOSF-LAQRGFTBSA-N |
| XLogP | 2.40 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|