C24H27N3O4S — CID 57090669
N-[(2S)-4-(butylamino)-3,4-dioxo-1-phenylbutan-2-yl]-2-methyl-4-oxo-3H-1,2-benzothiazine-3-carboxamide (PubChem CID 57090669) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is N-[(2S)-4-(butylamino)-3,4-dioxo-1-phenylbutan-2-yl]-2-methyl-4-oxo-3H-1,2-benzothiazine-3-carboxamide.
| Compound Name | N-[(2S)-4-(butylamino)-3,4-dioxo-1-phenylbutan-2-yl]-2-methyl-4-oxo-3H-1,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 57090669 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | N-[(2S)-4-(butylamino)-3,4-dioxo-1-phenylbutan-2-yl]-2-methyl-4-oxo-3H-1,2-benzothiazine-3-carboxamide |
| SMILES | CCCCNC(=O)C(=O)[C@H](Cc1ccccc1)NC(=O)C1C(=O)c2ccccc2SN1C |
| InChI | InChI=1S/C24H27N3O4S/c1-3-4-14-25-24(31)22(29)18(15-16-10-6-5-7-11-16)26-23(30)20-21(28)17-12-8-9-13-19(17)32-27(20)2/h5-13,18,20H,3-4,14-15H2,1-2H3,(H,25,31)(H,26,30)/t18-,20?/m0/s1 |
| InChIKey | SWGOOYFOYIWNHV-LROBGIAVSA-N |
| XLogP | 2.40 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|