C24H40O3 — CID 57090891
1-[(1R,2R,3aR,6aR)-2-hydroxy-5-(5-hydroxypentyl)-1,2,3,3a,6,6a-hexahydropentalen-1-yl]-9-methyldec-8-en-1-one (PubChem CID 57090891) has the molecular formula C24H40O3 and a molecular weight of 376.58 g/mol. Its IUPAC name is 1-[(1R,2R,3aR,6aR)-2-hydroxy-5-(5-hydroxypentyl)-1,2,3,3a,6,6a-hexahydropentalen-1-yl]-9-methyldec-8-en-1-one.
| Compound Name | 1-[(1R,2R,3aR,6aR)-2-hydroxy-5-(5-hydroxypentyl)-1,2,3,3a,6,6a-hexahydropentalen-1-yl]-9-methyldec-8-en-1-one |
|---|---|
| PubChem CID | 57090891 |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | 1-[(1R,2R,3aR,6aR)-2-hydroxy-5-(5-hydroxypentyl)-1,2,3,3a,6,6a-hexahydropentalen-1-yl]-9-methyldec-8-en-1-one |
| SMILES | CC(C)=CCCCCCCC(=O)[C@@H]1[C@@H]2CC(CCCCCO)=C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C24H40O3/c1-18(2)11-7-4-3-5-9-13-22(26)24-21-16-19(12-8-6-10-14-25)15-20(21)17-23(24)27/h11,15,20-21,23-25,27H,3-10,12-14,16-17H2,1-2H3/t20-,21-,23-,24+/m1/s1 |
| InChIKey | BDQQASUDLMKPLL-KOVSNXQUSA-N |
| XLogP | 5.36 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|