About tri(propan-2-yl)-(2,2,2-trifluoroacetyl)oxyphosphanium
tri(propan-2-yl)-(2,2,2-trifluoroacetyl)oxyphosphanium (PubChem CID 57090971) has the molecular formula C11H21F3O2P+
and a molecular weight of 273.26 g/mol. Its IUPAC name is tri(propan-2-yl)-(2,2,2-trifluoroacetyl)oxyphosphanium.
Molecular Properties
| Compound Name | tri(propan-2-yl)-(2,2,2-trifluoroacetyl)oxyphosphanium |
| PubChem CID | 57090971 |
| Molecular Formula | C11H21F3O2P+ |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | tri(propan-2-yl)-(2,2,2-trifluoroacetyl)oxyphosphanium |
| SMILES | CC(C)[P+](OC(=O)C(F)(F)F)(C(C)C)C(C)C |
| InChI | InChI=1S/C11H21F3O2P/c1-7(2)17(8(3)4,9(5)6)16-10(15)11(12,13)14/h7-9H,1-6H3/q+1 |
| InChIKey | HQMZDKLAPKRHKU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tri(propan-2-yl)-(2,2,2-trifluoroacetyl)oxyphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tri(propan-2-yl)-(2,2,2-trifluoroacetyl)oxyphosphanium?
The IUPAC name of tri(propan-2-yl)-(2,2,2-trifluoroacetyl)oxyphosphanium (CID 57090971) is tri(propan-2-yl)-(2,2,2-trifluoroacetyl)oxyphosphanium.
What is the SMILES notation for tri(propan-2-yl)-(2,2,2-trifluoroacetyl)oxyphosphanium?
The canonical SMILES for tri(propan-2-yl)-(2,2,2-trifluoroacetyl)oxyphosphanium is CC(C)[P+](OC(=O)C(F)(F)F)(C(C)C)C(C)C.
What is the InChIKey of tri(propan-2-yl)-(2,2,2-trifluoroacetyl)oxyphosphanium?
The InChIKey is HQMZDKLAPKRHKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F3O2P/c1-7(2)17(8(3)4,9(5)6)16-10(15)11(12,13)14/h7-9H,1-6H3/q+1.
What are the key properties of tri(propan-2-yl)-(2,2,2-trifluoroacetyl)oxyphosphanium?
tri(propan-2-yl)-(2,2,2-trifluoroacetyl)oxyphosphanium has a molecular weight of 273.26 g/mol, XLogP of 4.25, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tri(propan-2-yl)-(2,2,2-trifluoroacetyl)oxyphosphanium is sourced from PubChem (CID 57090971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).