About 3-iodopropanimidamide
3-iodopropanimidamide (PubChem CID 57091020) has the molecular formula C3H7IN2
and a molecular weight of 198.01 g/mol. Its IUPAC name is 3-iodopropanimidamide.
Molecular Properties
| Compound Name | 3-iodopropanimidamide |
| PubChem CID | 57091020 |
| Molecular Formula | C3H7IN2 |
| Molecular Weight | 198.01 g/mol |
| Exact Mass | 197.97 |
| IUPAC Name | 3-iodopropanimidamide |
| SMILES | [H]/N=C(/N)CCI |
| InChI | InChI=1S/C3H7IN2/c4-2-1-3(5)6/h1-2H2,(H3,5,6) |
| InChIKey | XECDJCGDHJSJGH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.01 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodopropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodopropanimidamide?
The IUPAC name of 3-iodopropanimidamide (CID 57091020) is 3-iodopropanimidamide.
What is the SMILES notation for 3-iodopropanimidamide?
The canonical SMILES for 3-iodopropanimidamide is [H]/N=C(/N)CCI.
What is the InChIKey of 3-iodopropanimidamide?
The InChIKey is XECDJCGDHJSJGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7IN2/c4-2-1-3(5)6/h1-2H2,(H3,5,6).
What are the key properties of 3-iodopropanimidamide?
3-iodopropanimidamide has a molecular weight of 198.01 g/mol, XLogP of 0.75, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodopropanimidamide is sourced from PubChem (CID 57091020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).