C20H26 — CID 57091499
4-[2-(4,5,6,7-tetrahydro-1H-inden-4-yl)ethyl]-4,5,6,7-tetrahydro-1H-indene (PubChem CID 57091499) has the molecular formula C20H26 and a molecular weight of 266.43 g/mol. Its IUPAC name is 4-[2-(4,5,6,7-tetrahydro-1H-inden-4-yl)ethyl]-4,5,6,7-tetrahydro-1H-indene.
| Compound Name | 4-[2-(4,5,6,7-tetrahydro-1H-inden-4-yl)ethyl]-4,5,6,7-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 57091499 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 4-[2-(4,5,6,7-tetrahydro-1H-inden-4-yl)ethyl]-4,5,6,7-tetrahydro-1H-indene |
| SMILES | C1=CC2=C(C1)CCCC2CCC1CCCC2=C1C=CC2 |
| InChI | InChI=1S/C20H26/c1-5-15-9-3-11-19(15)17(7-1)13-14-18-8-2-6-16-10-4-12-20(16)18/h3-4,11-12,17-18H,1-2,5-10,13-14H2 |
| InChIKey | RNYVAGGPVMVFNC-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |