C27H46O8 — CID 57091692
[7-ethyl-2-(4-methoxycarbonyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)-7-(methoxymethoxy)non-3-en-2-yl] methyl carbonate (PubChem CID 57091692) has the molecular formula C27H46O8 and a molecular weight of 498.66 g/mol. Its IUPAC name is [7-ethyl-2-(4-methoxycarbonyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)-7-(methoxymethoxy)non-3-en-2-yl] methyl carbonate.
| Compound Name | [7-ethyl-2-(4-methoxycarbonyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)-7-(methoxymethoxy)non-3-en-2-yl] methyl carbonate |
|---|---|
| PubChem CID | 57091692 |
| Molecular Formula | C27H46O8 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | [7-ethyl-2-(4-methoxycarbonyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)-7-(methoxymethoxy)non-3-en-2-yl] methyl carbonate |
| SMILES | CCC(CC)(CCC=CC(C)(OC(=O)OC)C1CCC2C(OC(=O)OC)CCCC21C)OCOC |
| InChI | InChI=1S/C27H46O8/c1-8-27(9-2,33-19-30-5)18-11-10-17-26(4,35-24(29)32-7)22-15-14-20-21(34-23(28)31-6)13-12-16-25(20,22)3/h10,17,20-22H,8-9,11-16,18-19H2,1-7H3 |
| InChIKey | QRGKXKSJNVICSI-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|