About (triphenyl-λ4-sulfanyl) acetate
(triphenyl-λ4-sulfanyl) acetate (PubChem CID 57091785) has the molecular formula C20H18O2S
and a molecular weight of 322.43 g/mol. Its IUPAC name is (triphenyl-λ4-sulfanyl) acetate.
Molecular Properties
| Compound Name | (triphenyl-λ4-sulfanyl) acetate |
| PubChem CID | 57091785 |
| Molecular Formula | C20H18O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | (triphenyl-λ4-sulfanyl) acetate |
| SMILES | CC(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18O2S/c1-17(21)22-23(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16H,1H3 |
| InChIKey | CRDMINKFWKKTMU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (triphenyl-λ4-sulfanyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (triphenyl-λ4-sulfanyl) acetate?
The IUPAC name of (triphenyl-λ4-sulfanyl) acetate (CID 57091785) is (triphenyl-λ4-sulfanyl) acetate.
What is the SMILES notation for (triphenyl-λ4-sulfanyl) acetate?
The canonical SMILES for (triphenyl-λ4-sulfanyl) acetate is CC(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of (triphenyl-λ4-sulfanyl) acetate?
The InChIKey is CRDMINKFWKKTMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18O2S/c1-17(21)22-23(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16H,1H3.
What are the key properties of (triphenyl-λ4-sulfanyl) acetate?
(triphenyl-λ4-sulfanyl) acetate has a molecular weight of 322.43 g/mol, XLogP of 5.45, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (triphenyl-λ4-sulfanyl) acetate is sourced from PubChem (CID 57091785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).