About 1-(4,5-dihydro-1,3-thiazol-2-ylamino)-3-(4-fluorophenyl)urea
1-(4,5-dihydro-1,3-thiazol-2-ylamino)-3-(4-fluorophenyl)urea (PubChem CID 57091911) has the molecular formula C10H11FN4OS
and a molecular weight of 254.29 g/mol. Its IUPAC name is 1-(4,5-dihydro-1,3-thiazol-2-ylamino)-3-(4-fluorophenyl)urea.
Molecular Properties
| Compound Name | 1-(4,5-dihydro-1,3-thiazol-2-ylamino)-3-(4-fluorophenyl)urea |
| PubChem CID | 57091911 |
| Molecular Formula | C10H11FN4OS |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 1-(4,5-dihydro-1,3-thiazol-2-ylamino)-3-(4-fluorophenyl)urea |
| SMILES | O=C(NNC1=NCCS1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C10H11FN4OS/c11-7-1-3-8(4-2-7)13-9(16)14-15-10-12-5-6-17-10/h1-4H,5-6H2,(H,12,15)(H2,13,14,16) |
| InChIKey | CKKMDBJIIFYNDE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,5-dihydro-1,3-thiazol-2-ylamino)-3-(4-fluorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dihydro-1,3-thiazol-2-ylamino)-3-(4-fluorophenyl)urea?
The IUPAC name of 1-(4,5-dihydro-1,3-thiazol-2-ylamino)-3-(4-fluorophenyl)urea (CID 57091911) is 1-(4,5-dihydro-1,3-thiazol-2-ylamino)-3-(4-fluorophenyl)urea.
What is the SMILES notation for 1-(4,5-dihydro-1,3-thiazol-2-ylamino)-3-(4-fluorophenyl)urea?
The canonical SMILES for 1-(4,5-dihydro-1,3-thiazol-2-ylamino)-3-(4-fluorophenyl)urea is O=C(NNC1=NCCS1)Nc1ccc(F)cc1.
What is the InChIKey of 1-(4,5-dihydro-1,3-thiazol-2-ylamino)-3-(4-fluorophenyl)urea?
The InChIKey is CKKMDBJIIFYNDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN4OS/c11-7-1-3-8(4-2-7)13-9(16)14-15-10-12-5-6-17-10/h1-4H,5-6H2,(H,12,15)(H2,13,14,16).
What are the key properties of 1-(4,5-dihydro-1,3-thiazol-2-ylamino)-3-(4-fluorophenyl)urea?
1-(4,5-dihydro-1,3-thiazol-2-ylamino)-3-(4-fluorophenyl)urea has a molecular weight of 254.29 g/mol, XLogP of 1.55, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dihydro-1,3-thiazol-2-ylamino)-3-(4-fluorophenyl)urea is sourced from PubChem (CID 57091911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).