C22H45NO — CID 57092479
2,4,8,12-tetramethyl-2-piperidin-1-yltridecan-3-ol (PubChem CID 57092479) has the molecular formula C22H45NO and a molecular weight of 339.61 g/mol. Its IUPAC name is 2,4,8,12-tetramethyl-2-piperidin-1-yltridecan-3-ol.
| Compound Name | 2,4,8,12-tetramethyl-2-piperidin-1-yltridecan-3-ol |
|---|---|
| PubChem CID | 57092479 |
| Molecular Formula | C22H45NO |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 339.35 |
| IUPAC Name | 2,4,8,12-tetramethyl-2-piperidin-1-yltridecan-3-ol |
| SMILES | CC(C)CCCC(C)CCCC(C)C(O)C(C)(C)N1CCCCC1 |
| InChI | InChI=1S/C22H45NO/c1-18(2)12-10-13-19(3)14-11-15-20(4)21(24)22(5,6)23-16-8-7-9-17-23/h18-21,24H,7-17H2,1-6H3 |
| InChIKey | RJRIIJCCSDBIHV-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |