C48H52N4O5 — CID 57092545
benzyl (5S)-6-[[(2S)-4-amino-1-naphthalen-2-yl-4-oxobutan-2-yl]-pentylamino]-5-[(1-benzylindole-3-carbonyl)amino]-6-oxohexanoate (PubChem CID 57092545) has the molecular formula C48H52N4O5 and a molecular weight of 764.97 g/mol. Its IUPAC name is benzyl (5S)-6-[[(2S)-4-amino-1-naphthalen-2-yl-4-oxobutan-2-yl]-pentylamino]-5-[(1-benzylindole-3-carbonyl)amino]-6-oxohexanoate.
| Compound Name | benzyl (5S)-6-[[(2S)-4-amino-1-naphthalen-2-yl-4-oxobutan-2-yl]-pentylamino]-5-[(1-benzylindole-3-carbonyl)amino]-6-oxohexanoate |
|---|---|
| PubChem CID | 57092545 |
| Molecular Formula | C48H52N4O5 |
| Molecular Weight | 764.97 g/mol |
| Exact Mass | 764.39 |
| IUPAC Name | benzyl (5S)-6-[[(2S)-4-amino-1-naphthalen-2-yl-4-oxobutan-2-yl]-pentylamino]-5-[(1-benzylindole-3-carbonyl)amino]-6-oxohexanoate |
| SMILES | CCCCCN(C(=O)[C@H](CCCC(=O)OCc1ccccc1)NC(=O)c1cn(Cc2ccccc2)c2ccccc12)[C@H](CC(N)=O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C48H52N4O5/c1-2-3-14-28-52(40(31-45(49)53)30-37-26-27-38-20-10-11-21-39(38)29-37)48(56)43(23-15-25-46(54)57-34-36-18-8-5-9-19-36)50-47(55)42-33-51(32-35-16-6-4-7-17-35)44-24-13-12-22-41(42)44/h4-13,16-22,24,26-27,29,33,40,43H,2-3,14-15,23,25,28,30-32,34H2,1H3,(H2,49,53)(H,50,55)/t40-,43-/m0/s1 |
| InChIKey | HKYQLPOMBTYXCI-NWFICIJOSA-N |
| XLogP | 8.36 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.97 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|