C25H27ClN2O2S — CID 57092777
(3-chlorophenyl) N-[3-(1,2,3,4,6,7,8,9,10,10a-decahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophen-5-yl]carbamate (PubChem CID 57092777) has the molecular formula C25H27ClN2O2S and a molecular weight of 455.02 g/mol. Its IUPAC name is (3-chlorophenyl) N-[3-(1,2,3,4,6,7,8,9,10,10a-decahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophen-5-yl]carbamate.
| Compound Name | (3-chlorophenyl) N-[3-(1,2,3,4,6,7,8,9,10,10a-decahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophen-5-yl]carbamate |
|---|---|
| PubChem CID | 57092777 |
| Molecular Formula | C25H27ClN2O2S |
| Molecular Weight | 455.02 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | (3-chlorophenyl) N-[3-(1,2,3,4,6,7,8,9,10,10a-decahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophen-5-yl]carbamate |
| SMILES | O=C(Nc1ccc2scc(C3CCC4CCCCN4CC3)c2c1)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C25H27ClN2O2S/c26-18-4-3-6-21(14-18)30-25(29)27-19-8-10-24-22(15-19)23(16-31-24)17-7-9-20-5-1-2-12-28(20)13-11-17/h3-4,6,8,10,14-17,20H,1-2,5,7,9,11-13H2,(H,27,29) |
| InChIKey | RVBGMIRGMAJTRA-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.02 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |