C14H24N4O3S — CID 57092831
2,6-diethyl-4-(2-morpholin-4-ylethyliminomethyl)-1,2,6-thiadiazinane-3,5-dione (PubChem CID 57092831) has the molecular formula C14H24N4O3S and a molecular weight of 328.44 g/mol. Its IUPAC name is 2,6-diethyl-4-(2-morpholin-4-ylethyliminomethyl)-1,2,6-thiadiazinane-3,5-dione.
| Compound Name | 2,6-diethyl-4-(2-morpholin-4-ylethyliminomethyl)-1,2,6-thiadiazinane-3,5-dione |
|---|---|
| PubChem CID | 57092831 |
| Molecular Formula | C14H24N4O3S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 2,6-diethyl-4-(2-morpholin-4-ylethyliminomethyl)-1,2,6-thiadiazinane-3,5-dione |
| SMILES | CCN1SN(CC)C(=O)C(/C=N/CCN2CCOCC2)C1=O |
| InChI | InChI=1S/C14H24N4O3S/c1-3-17-13(19)12(14(20)18(4-2)22-17)11-15-5-6-16-7-9-21-10-8-16/h11-12H,3-10H2,1-2H3/b15-11+ |
| InChIKey | AHUJRKILPACEOA-RVDMUPIBSA-N |
| XLogP | 0.28 |
| TPSA | 65.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|