C35H57N3O6 — CID 57092906
3-[2-[(1-octylcyclobutyl)carbamoylamino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid (PubChem CID 57092906) has the molecular formula C35H57N3O6 and a molecular weight of 615.86 g/mol. Its IUPAC name is 3-[2-[(1-octylcyclobutyl)carbamoylamino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[2-[(1-octylcyclobutyl)carbamoylamino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 57092906 |
| Molecular Formula | C35H57N3O6 |
| Molecular Weight | 615.86 g/mol |
| Exact Mass | 615.42 |
| IUPAC Name | 3-[2-[(1-octylcyclobutyl)carbamoylamino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid |
| SMILES | CCCCCCCCC1(NC(=O)NC2CCCCC2C(CC(=O)O)c2[nH]ccc2C(=O)C2OC(C)(C)OCC2(C)C)CCC1 |
| InChI | InChI=1S/C35H57N3O6/c1-6-7-8-9-10-13-18-35(19-14-20-35)38-32(42)37-27-16-12-11-15-24(27)26(22-28(39)40)29-25(17-21-36-29)30(41)31-33(2,3)23-43-34(4,5)44-31/h17,21,24,26-27,31,36H,6-16,18-20,22-23H2,1-5H3,(H,39,40)(H2,37,38,42) |
| InChIKey | FDGRUMHSSTZQNV-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.86 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|