About 5-[[1-(3,3-dimethylcyclohexylidene)-2-imidazol-1-ylethyl]amino]oxypentanoic acid
5-[[1-(3,3-dimethylcyclohexylidene)-2-imidazol-1-ylethyl]amino]oxypentanoic acid (PubChem CID 57092936) has the molecular formula C18H29N3O3
and a molecular weight of 335.45 g/mol. Its IUPAC name is 5-[[1-(3,3-dimethylcyclohexylidene)-2-imidazol-1-ylethyl]amino]oxypentanoic acid.
Molecular Properties
| Compound Name | 5-[[1-(3,3-dimethylcyclohexylidene)-2-imidazol-1-ylethyl]amino]oxypentanoic acid |
| PubChem CID | 57092936 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 5-[[1-(3,3-dimethylcyclohexylidene)-2-imidazol-1-ylethyl]amino]oxypentanoic acid |
| SMILES | CC1(C)CCCC(=C(Cn2ccnc2)NOCCCCC(=O)O)C1 |
| InChI | InChI=1S/C18H29N3O3/c1-18(2)8-5-6-15(12-18)16(13-21-10-9-19-14-21)20-24-11-4-3-7-17(22)23/h9-10,14,20H,3-8,11-13H2,1-2H3,(H,22,23) |
| InChIKey | SZYRPPSRJZVTFF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[[1-(3,3-dimethylcyclohexylidene)-2-imidazol-1-ylethyl]amino]oxypentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[1-(3,3-dimethylcyclohexylidene)-2-imidazol-1-ylethyl]amino]oxypentanoic acid?
The IUPAC name of 5-[[1-(3,3-dimethylcyclohexylidene)-2-imidazol-1-ylethyl]amino]oxypentanoic acid (CID 57092936) is 5-[[1-(3,3-dimethylcyclohexylidene)-2-imidazol-1-ylethyl]amino]oxypentanoic acid.
What is the SMILES notation for 5-[[1-(3,3-dimethylcyclohexylidene)-2-imidazol-1-ylethyl]amino]oxypentanoic acid?
The canonical SMILES for 5-[[1-(3,3-dimethylcyclohexylidene)-2-imidazol-1-ylethyl]amino]oxypentanoic acid is CC1(C)CCCC(=C(Cn2ccnc2)NOCCCCC(=O)O)C1.
What is the InChIKey of 5-[[1-(3,3-dimethylcyclohexylidene)-2-imidazol-1-ylethyl]amino]oxypentanoic acid?
The InChIKey is SZYRPPSRJZVTFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N3O3/c1-18(2)8-5-6-15(12-18)16(13-21-10-9-19-14-21)20-24-11-4-3-7-17(22)23/h9-10,14,20H,3-8,11-13H2,1-2H3,(H,22,23).
What are the key properties of 5-[[1-(3,3-dimethylcyclohexylidene)-2-imidazol-1-ylethyl]amino]oxypentanoic acid?
5-[[1-(3,3-dimethylcyclohexylidene)-2-imidazol-1-ylethyl]amino]oxypentanoic acid has a molecular weight of 335.45 g/mol, XLogP of 3.51, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[1-(3,3-dimethylcyclohexylidene)-2-imidazol-1-ylethyl]amino]oxypentanoic acid is sourced from PubChem (CID 57092936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).