C22H25ClN2O3 — CID 57093421
5-[[(3-chlorobenzoyl)amino]methyl]-2-(cyclohexylmethoxy)benzamide (PubChem CID 57093421) has the molecular formula C22H25ClN2O3 and a molecular weight of 400.91 g/mol. Its IUPAC name is 5-[[(3-chlorobenzoyl)amino]methyl]-2-(cyclohexylmethoxy)benzamide.
| Compound Name | 5-[[(3-chlorobenzoyl)amino]methyl]-2-(cyclohexylmethoxy)benzamide |
|---|---|
| PubChem CID | 57093421 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 5-[[(3-chlorobenzoyl)amino]methyl]-2-(cyclohexylmethoxy)benzamide |
| SMILES | NC(=O)c1cc(CNC(=O)c2cccc(Cl)c2)ccc1OCC1CCCCC1 |
| InChI | InChI=1S/C22H25ClN2O3/c23-18-8-4-7-17(12-18)22(27)25-13-16-9-10-20(19(11-16)21(24)26)28-14-15-5-2-1-3-6-15/h4,7-12,15H,1-3,5-6,13-14H2,(H2,24,26)(H,25,27) |
| InChIKey | AUVARCLIIVUQEX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |