C23H36O3 — CID 57093583
7-[(1R,2R,3R,4S)-3-(4-cyclopentyl-3-hydroxybut-1-enyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid (PubChem CID 57093583) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is 7-[(1R,2R,3R,4S)-3-(4-cyclopentyl-3-hydroxybut-1-enyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R,4S)-3-(4-cyclopentyl-3-hydroxybut-1-enyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57093583 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | 7-[(1R,2R,3R,4S)-3-(4-cyclopentyl-3-hydroxybut-1-enyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@@H]1[C@@H]2CC[C@@H](C2)[C@@H]1C=CC(O)CC1CCCC1 |
| InChI | InChI=1S/C23H36O3/c24-20(15-17-7-5-6-8-17)13-14-22-19-12-11-18(16-19)21(22)9-3-1-2-4-10-23(25)26/h1,3,13-14,17-22,24H,2,4-12,15-16H2,(H,25,26)/t18-,19+,20?,21-,22+/m1/s1 |
| InChIKey | UHOQTYVNDXALBJ-UWFUTDFQSA-N |
| XLogP | 5.35 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|