C26H34N6O4S2+2 — CID 57093666
bis[5-[4-(cyclopropylmethyl)-1,2,5-thiadiazol-3-yl]-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl] oxalate (PubChem CID 57093666) has the molecular formula C26H34N6O4S2+2 and a molecular weight of 558.73 g/mol. Its IUPAC name is bis[5-[4-(cyclopropylmethyl)-1,2,5-thiadiazol-3-yl]-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl] oxalate.
| Compound Name | bis[5-[4-(cyclopropylmethyl)-1,2,5-thiadiazol-3-yl]-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl] oxalate |
|---|---|
| PubChem CID | 57093666 |
| Molecular Formula | C26H34N6O4S2+2 |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | bis[5-[4-(cyclopropylmethyl)-1,2,5-thiadiazol-3-yl]-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl] oxalate |
| SMILES | C[N+]1(OC(=O)C(=O)O[N+]2(C)CCC=C(c3nsnc3CC3CC3)C2)CCC=C(c2nsnc2CC2CC2)C1 |
| InChI | InChI=1S/C26H34N6O4S2/c1-31(11-3-5-19(15-31)23-21(27-37-29-23)13-17-7-8-17)35-25(33)26(34)36-32(2)12-4-6-20(16-32)24-22(28-38-30-24)14-18-9-10-18/h5-6,17-18H,3-4,7-16H2,1-2H3/q+2 |
| InChIKey | XVGKFIZTHXRBOJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 104.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|