C16H28N2O — CID 57093872
3-[(2,2,4-trimethyl-3,4,4a,5,6,7,8,8a-octahydroquinolin-1-yl)methoxy]propanenitrile (PubChem CID 57093872) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is 3-[(2,2,4-trimethyl-3,4,4a,5,6,7,8,8a-octahydroquinolin-1-yl)methoxy]propanenitrile.
| Compound Name | 3-[(2,2,4-trimethyl-3,4,4a,5,6,7,8,8a-octahydroquinolin-1-yl)methoxy]propanenitrile |
|---|---|
| PubChem CID | 57093872 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 3-[(2,2,4-trimethyl-3,4,4a,5,6,7,8,8a-octahydroquinolin-1-yl)methoxy]propanenitrile |
| SMILES | CC1CC(C)(C)N(COCCC#N)C2CCCCC12 |
| InChI | InChI=1S/C16H28N2O/c1-13-11-16(2,3)18(12-19-10-6-9-17)15-8-5-4-7-14(13)15/h13-15H,4-8,10-12H2,1-3H3 |
| InChIKey | VRVVKTWXUBLBJA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|