C27H36N2O3S — CID 57094300
butyl 5-[2-amino-3-(1,2,3,4,6,9,10,10a-octahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophen-5-yl]-5-oxopentanoate (PubChem CID 57094300) has the molecular formula C27H36N2O3S and a molecular weight of 468.66 g/mol. Its IUPAC name is butyl 5-[2-amino-3-(1,2,3,4,6,9,10,10a-octahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophen-5-yl]-5-oxopentanoate.
| Compound Name | butyl 5-[2-amino-3-(1,2,3,4,6,9,10,10a-octahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophen-5-yl]-5-oxopentanoate |
|---|---|
| PubChem CID | 57094300 |
| Molecular Formula | C27H36N2O3S |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | butyl 5-[2-amino-3-(1,2,3,4,6,9,10,10a-octahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophen-5-yl]-5-oxopentanoate |
| SMILES | CCCCOC(=O)CCCC(=O)c1ccc2sc(N)c(C3=CCN4CCCCC4CC3)c2c1 |
| InChI | InChI=1S/C27H36N2O3S/c1-2-3-17-32-25(31)9-6-8-23(30)20-11-13-24-22(18-20)26(27(28)33-24)19-10-12-21-7-4-5-15-29(21)16-14-19/h11,13-14,18,21H,2-10,12,15-17,28H2,1H3 |
| InChIKey | MRKNNGHIKYWAHU-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|