C9H20NO4P — CID 57094425
3-[(4-methyl-1-oxopentan-2-yl)amino]propylphosphonic acid (PubChem CID 57094425) has the molecular formula C9H20NO4P and a molecular weight of 237.24 g/mol. Its IUPAC name is 3-[(4-methyl-1-oxopentan-2-yl)amino]propylphosphonic acid.
| Compound Name | 3-[(4-methyl-1-oxopentan-2-yl)amino]propylphosphonic acid |
|---|---|
| PubChem CID | 57094425 |
| Molecular Formula | C9H20NO4P |
| Molecular Weight | 237.24 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 3-[(4-methyl-1-oxopentan-2-yl)amino]propylphosphonic acid |
| SMILES | CC(C)CC(C=O)NCCCP(=O)(O)O |
| InChI | InChI=1S/C9H20NO4P/c1-8(2)6-9(7-11)10-4-3-5-15(12,13)14/h7-10H,3-6H2,1-2H3,(H2,12,13,14) |
| InChIKey | AYEUDKUEWGLGSE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.24 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|