C17H28N4 — CID 57094492
(5aR,9aR)-N,N,6-triethyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-2-amine (PubChem CID 57094492) has the molecular formula C17H28N4 and a molecular weight of 288.44 g/mol. Its IUPAC name is (5aR,9aR)-N,N,6-triethyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-2-amine.
| Compound Name | (5aR,9aR)-N,N,6-triethyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-2-amine |
|---|---|
| PubChem CID | 57094492 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | (5aR,9aR)-N,N,6-triethyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-2-amine |
| SMILES | CCN(CC)c1ncc2c(n1)C[C@H]1CCCN(CC)[C@@H]1C2 |
| InChI | InChI=1S/C17H28N4/c1-4-20(5-2)17-18-12-14-11-16-13(10-15(14)19-17)8-7-9-21(16)6-3/h12-13,16H,4-11H2,1-3H3/t13-,16-/m1/s1 |
| InChIKey | WXDCMPUWCMMAHO-CZUORRHYSA-N |
| XLogP | 2.52 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |