About 1-(1H-imidazol-2-yl)propane-1,2,3-triol
1-(1H-imidazol-2-yl)propane-1,2,3-triol (PubChem CID 57094595) has the molecular formula C6H10N2O3
and a molecular weight of 158.16 g/mol. Its IUPAC name is 1-(1H-imidazol-2-yl)propane-1,2,3-triol.
Molecular Properties
| Compound Name | 1-(1H-imidazol-2-yl)propane-1,2,3-triol |
| PubChem CID | 57094595 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 1-(1H-imidazol-2-yl)propane-1,2,3-triol |
| SMILES | OCC(O)C(O)c1ncc[nH]1 |
| InChI | InChI=1S/C6H10N2O3/c9-3-4(10)5(11)6-7-1-2-8-6/h1-2,4-5,9-11H,3H2,(H,7,8) |
| InChIKey | IVBBRVGDLPIXLJ-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1H-imidazol-2-yl)propane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-imidazol-2-yl)propane-1,2,3-triol?
The IUPAC name of 1-(1H-imidazol-2-yl)propane-1,2,3-triol (CID 57094595) is 1-(1H-imidazol-2-yl)propane-1,2,3-triol.
What is the SMILES notation for 1-(1H-imidazol-2-yl)propane-1,2,3-triol?
The canonical SMILES for 1-(1H-imidazol-2-yl)propane-1,2,3-triol is OCC(O)C(O)c1ncc[nH]1.
What is the InChIKey of 1-(1H-imidazol-2-yl)propane-1,2,3-triol?
The InChIKey is IVBBRVGDLPIXLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O3/c9-3-4(10)5(11)6-7-1-2-8-6/h1-2,4-5,9-11H,3H2,(H,7,8).
What are the key properties of 1-(1H-imidazol-2-yl)propane-1,2,3-triol?
1-(1H-imidazol-2-yl)propane-1,2,3-triol has a molecular weight of 158.16 g/mol, XLogP of -1.20, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-imidazol-2-yl)propane-1,2,3-triol is sourced from PubChem (CID 57094595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).