C15H26F4N2O2+2 — CID 57095004
(2-fluoro-1,3-dipentyl-4,5-dihydroimidazole-1,3-diium-1-yl) 2,2,2-trifluoroacetate (PubChem CID 57095004) has the molecular formula C15H26F4N2O2+2 and a molecular weight of 342.38 g/mol. Its IUPAC name is (2-fluoro-1,3-dipentyl-4,5-dihydroimidazole-1,3-diium-1-yl) 2,2,2-trifluoroacetate.
| Compound Name | (2-fluoro-1,3-dipentyl-4,5-dihydroimidazole-1,3-diium-1-yl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 57095004 |
| Molecular Formula | C15H26F4N2O2+2 |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (2-fluoro-1,3-dipentyl-4,5-dihydroimidazole-1,3-diium-1-yl) 2,2,2-trifluoroacetate |
| SMILES | CCCCC[N+]1=C(F)[N+](CCCCC)(OC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H26F4N2O2/c1-3-5-7-9-20-10-12-21(14(20)16,11-8-6-4-2)23-13(22)15(17,18)19/h3-12H2,1-2H3/q+2 |
| InChIKey | LLDLJWXEAJZWQT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|