C14H23N7OS — CID 57095051
3-N-[3-[4-(piperidin-1-ylmethyl)pyrazol-1-yl]oxypropyl]-1,2,5-thiadiazole-3,4-diamine (PubChem CID 57095051) has the molecular formula C14H23N7OS and a molecular weight of 337.45 g/mol. Its IUPAC name is 3-N-[3-[4-(piperidin-1-ylmethyl)pyrazol-1-yl]oxypropyl]-1,2,5-thiadiazole-3,4-diamine.
| Compound Name | 3-N-[3-[4-(piperidin-1-ylmethyl)pyrazol-1-yl]oxypropyl]-1,2,5-thiadiazole-3,4-diamine |
|---|---|
| PubChem CID | 57095051 |
| Molecular Formula | C14H23N7OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 3-N-[3-[4-(piperidin-1-ylmethyl)pyrazol-1-yl]oxypropyl]-1,2,5-thiadiazole-3,4-diamine |
| SMILES | Nc1nsnc1NCCCOn1cc(CN2CCCCC2)cn1 |
| InChI | InChI=1S/C14H23N7OS/c15-13-14(19-23-18-13)16-5-4-8-22-21-11-12(9-17-21)10-20-6-2-1-3-7-20/h9,11H,1-8,10H2,(H2,15,18)(H,16,19) |
| InChIKey | FDBWGHLJVDSLBM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|