C6H5N3S2 — CID 57095115
4H-pyrido[4,3-e][1,2,4]thiadiazine-3-thione (PubChem CID 57095115) has the molecular formula C6H5N3S2 and a molecular weight of 183.26 g/mol. Its IUPAC name is 4H-pyrido[4,3-e][1,2,4]thiadiazine-3-thione.
| Compound Name | 4H-pyrido[4,3-e][1,2,4]thiadiazine-3-thione |
|---|---|
| PubChem CID | 57095115 |
| Molecular Formula | C6H5N3S2 |
| Molecular Weight | 183.26 g/mol |
| Exact Mass | 182.99 |
| IUPAC Name | 4H-pyrido[4,3-e][1,2,4]thiadiazine-3-thione |
| SMILES | S=C1NSc2cnccc2N1 |
| InChI | InChI=1S/C6H5N3S2/c10-6-8-4-1-2-7-3-5(4)11-9-6/h1-3H,(H2,8,9,10) |
| InChIKey | LEFHAQMTKGEXOL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|