C21H25FO3 — CID 57095173
(1S,8S,9S,10R,13S,14S)-1-fluoro-10,13-dimethyl-2,6-dimethylidene-1,5,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,4,17-trione (PubChem CID 57095173) has the molecular formula C21H25FO3 and a molecular weight of 344.43 g/mol. Its IUPAC name is (1S,8S,9S,10R,13S,14S)-1-fluoro-10,13-dimethyl-2,6-dimethylidene-1,5,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,4,17-trione.
| Compound Name | (1S,8S,9S,10R,13S,14S)-1-fluoro-10,13-dimethyl-2,6-dimethylidene-1,5,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,4,17-trione |
|---|---|
| PubChem CID | 57095173 |
| Molecular Formula | C21H25FO3 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (1S,8S,9S,10R,13S,14S)-1-fluoro-10,13-dimethyl-2,6-dimethylidene-1,5,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,4,17-trione |
| SMILES | C=C1C[C@@H]2[C@H](CC[C@]3(C)C(=O)CC[C@@H]23)[C@]2(C)C1C(=O)C(=O)C(=C)[C@H]2F |
| InChI | InChI=1S/C21H25FO3/c1-10-9-12-13-5-6-15(23)20(13,3)8-7-14(12)21(4)16(10)18(25)17(24)11(2)19(21)22/h12-14,16,19H,1-2,5-9H2,3-4H3/t12-,13-,14-,16?,19+,20-,21+/m0/s1 |
| InChIKey | XXCQQVWDFOTRHX-NBXIGHCCSA-N |
| XLogP | 3.63 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|