C27H42ClNO4 — CID 57095203
(8S,9S,10S,13S,14S,17S)-17-(2-chloroacetyl)-2-(2,2-dimethylmorpholin-4-yl)-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one (PubChem CID 57095203) has the molecular formula C27H42ClNO4 and a molecular weight of 480.09 g/mol. Its IUPAC name is (8S,9S,10S,13S,14S,17S)-17-(2-chloroacetyl)-2-(2,2-dimethylmorpholin-4-yl)-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one.
| Compound Name | (8S,9S,10S,13S,14S,17S)-17-(2-chloroacetyl)-2-(2,2-dimethylmorpholin-4-yl)-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one |
|---|---|
| PubChem CID | 57095203 |
| Molecular Formula | C27H42ClNO4 |
| Molecular Weight | 480.09 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | (8S,9S,10S,13S,14S,17S)-17-(2-chloroacetyl)-2-(2,2-dimethylmorpholin-4-yl)-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one |
| SMILES | CC1(C)CN(C2C[C@@]3(C)C(CC[C@H]4[C@@H]5CC[C@H](C(=O)CCl)[C@@]5(C)CC(=O)[C@@H]43)CC2O)CCO1 |
| InChI | InChI=1S/C27H42ClNO4/c1-25(2)15-29(9-10-33-25)20-12-26(3)16(11-21(20)30)5-6-17-18-7-8-19(23(32)14-28)27(18,4)13-22(31)24(17)26/h16-21,24,30H,5-15H2,1-4H3/t16?,17-,18-,19+,20?,21?,24+,26-,27-/m0/s1 |
| InChIKey | NCVCFXXZQGVKRK-XBZRXTFESA-N |
| XLogP | 4.08 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.09 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|