C23H43NO5 — CID 57095449
tert-butyl (4S,5R)-4-(cyclohexylmethyl)-5-[(1S)-1,4-dihydroxy-3,3-dimethylbutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 57095449) has the molecular formula C23H43NO5 and a molecular weight of 413.60 g/mol. Its IUPAC name is tert-butyl (4S,5R)-4-(cyclohexylmethyl)-5-[(1S)-1,4-dihydroxy-3,3-dimethylbutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5R)-4-(cyclohexylmethyl)-5-[(1S)-1,4-dihydroxy-3,3-dimethylbutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 57095449 |
| Molecular Formula | C23H43NO5 |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.31 |
| IUPAC Name | tert-butyl (4S,5R)-4-(cyclohexylmethyl)-5-[(1S)-1,4-dihydroxy-3,3-dimethylbutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(CO)C[C@H](O)[C@@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@H]1CC1CCCCC1 |
| InChI | InChI=1S/C23H43NO5/c1-21(2,3)29-20(27)24-17(13-16-11-9-8-10-12-16)19(28-23(24,6)7)18(26)14-22(4,5)15-25/h16-19,25-26H,8-15H2,1-7H3/t17-,18-,19+/m0/s1 |
| InChIKey | MACMDWYWHXADJN-GBESFXJTSA-N |
| XLogP | 4.47 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |