C10H16N4O2 — CID 57095527
prop-2-enyl N-[[1-(methylaminomethyl)imidazol-4-yl]methyl]carbamate (PubChem CID 57095527) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is prop-2-enyl N-[[1-(methylaminomethyl)imidazol-4-yl]methyl]carbamate.
| Compound Name | prop-2-enyl N-[[1-(methylaminomethyl)imidazol-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 57095527 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | prop-2-enyl N-[[1-(methylaminomethyl)imidazol-4-yl]methyl]carbamate |
| SMILES | C=CCOC(=O)NCc1cn(CNC)cn1 |
| InChI | InChI=1S/C10H16N4O2/c1-3-4-16-10(15)12-5-9-6-14(7-11-2)8-13-9/h3,6,8,11H,1,4-5,7H2,2H3,(H,12,15) |
| InChIKey | RQDKBEIOYOUSEG-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|